Daunorubicin Impurity 1
Daunorubicin Impurity 1 is an impurity of Daunorubicin, which is an anthracycline antibiotic used in the treatment of acute myeloid and lymphocytic leukemia, with adverse reactions such as cardiotoxicity and bone marrow suppression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 51996-45-3 |
| Pricing | Inquire |
| Cas | 51996-45-3 |
| Molecular Weight | 243.18 |
| Molecular Formula | C8H12F3NO4 |
| Canonical SMILES | CC1C(C(CC(O1)O)NC(=O)C(F)(F)F)O |