Potassium trifluoro(pentafluoroethyl)borate
Organotrifluoroborate involved in:• Suzuki Miyaura cross-coupling reactions, and polymerization reactions• Synthesis of photonic crystals• Synthesis of sensitizers for dye-sensitized solar cells• Mannich / diastereoselective hydroamination reaction sequenceOrganotrifluoroborates as versatile and stable boronic acid surrogates
| Supplier | BOC Sciences |
|---|---|
| Product # | 476639-90-4 |
| Pricing | Inquire |
| Cas | 476639-90-4 |
| Molecular Weight | 225.918 |
| Molecular Formula | C2BF8K |
| Canonical SMILES | [B-](C(C(F)(F)F)(F)F)(F)(F)F.[K+] |