5-Hydroxy-6-methoxy Duloxetine Sulfate
5-Hydroxy-6-methoxy Duloxetine Sulfate is a metabolite of Duloxetine, which is a serotonin-norepinephrine reuptake inhibitor used to treat major depressive disorder, generalized anxiety disorder, fibromyalgia, neuropathic pain and central sensitization.
| Supplier | BOC Sciences |
|---|---|
| Product # | 732983-57-2 |
| Pricing | Inquire |
| Cas | 732983-57-2 |
| Molecular Weight | 423.50 |
| Molecular Formula | C19H21NO6S2 |
| Canonical SMILES | CNCCC(C1=CC=CS1)OC2=CC=CC3=C2C=CC(=C3OS(=O)(=O)O)OC |