5'-O-DMT-N2-isobutyryl-2'-O-propargylguanosine
5'-O-DMT-N2-isobutyryl-2'-O-propargylguanosine is an advanced compound prescribed for research of viral infections, demonstrating inhibitory efficacy by selectively targeting specific RNA viruses. Employing a potent mechanism of inhibiting viral replication and considerably attenuating viral loads, this compound exhibits promising potential in the research of RNA virus-induced ailments such as influenza and hepatitis C.
| Supplier | BOC Sciences |
|---|---|
| Product # | 171486-53-6 |
| Pricing | Inquire |
| Cas | 171486-53-6 |
| Molecular Weight | 693.74 |
| Molecular Formula | C38H39N5O8 |
| Canonical SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O)OCC#C |