VPS34 inhibitor 1
VPS34 inhibitor 1 is a potent and selective inhibitor of VPS34 (IC50 = 15 nM). Vps34 is a phosphoinositide 3-kinase (PI3K) class III isoform that has attracted major attention over the recent years because of its role in autophagy. VPS34 inhibitors can be used to investigate autophagy, a degradation process that recycles cellular components.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1383716-46-8 |
| Pricing | Inquire |
| Cas | 1383716-46-8 |
| Molecular Weight | 391.47 |
| Molecular Formula | C21H25N7O |
| Canonical SMILES | CC(C)(CNC1=NC=C(C(=N1)CC2CC2)C3=NC(=NC=C3)NC4=CC=NC=C4)O |