Telbivudine-[13C,15N2]
Telbivudine-[13C,15N2] is a labelled compound of Telbivudine. Telbivudine is an antiviral drug used in the treatment of hepatitis B infection. It is marketed by Swiss pharmaceutical company Novartis under the trade names Sebivo (Europe) and Tyzeka (United States). Clinical trials have shown it to be significantly more effective than lamivudine or adefovir, and less likely to cause resistance.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-004570 |
| Pricing | Inquire |
| Molecular Weight | 245.21 |
| Molecular Formula | C9[13C]H14[15N]2O5 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)O |