D-Folic Acid
One of the impurities of Folic acid. Folic acid is a vitamin needed to synthesize DNA, conduct DNA repair and methylate DNA, and it also acts as a cofactor in biological reactions involving folate.
| Supplier | BOC Sciences |
|---|---|
| Product # | 65165-91-5 |
| Pricing | Inquire |
| Cas | 65165-91-5 |
| Molecular Weight | 441.40 |
| Molecular Formula | C19H19N7O6 |
| Canonical SMILES | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N |