D-Glucose-1,6-diphosphate
D-Glucose-1,6-diphosphate is a pivotal chemical entity extensively employed in the research of the intricate process of cellular metabolism. Serving as an intermediary within the glycolysis pathway, this remarkable product holds immense significance in pharmaceutical research endeavors concerning a wide range of metabolic anomalies and glucose metabolism-associated disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 305-58-8 |
| Pricing | Inquire |
| Cas | 305-58-8 |
| Molecular Weight | 340.12 |
| Molecular Formula | C6H14O12P2 |
| Canonical SMILES | C(C1C(C(C(C(O1)OP(=O)(O)O)O)O)O)OP(=O)(O)O |