5'-O-(4,4'-dimethoxytrityl)-2'-O-propargyl-5-methyluridine
It is used for the synthesis of 2'-modified nucleoside phosphoramidites and corresponding modified RNA oligomers. This modified nucleoside exhibits the exceptional ability to integrate into RNA molecules, thereby facilitating the exploration of RNA's intricate structure and functionality.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00761 |
| Pricing | Inquire |
| Cas | 860640-56-8 |
| Molecular Weight | 598.64 |
| Molecular Formula | C34H34N2O8 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O)OCC#C |