1,2,4,6-Tetra-O-acetyl-3-O-allyl-β-D-glucopyranose
1,2,4,6-Tetra-O-acetyl-3-O-allyl-β-D-glucopyranose is a multifaceted and versatile chemical compound widely employed in drug development and synthesis to tackle a diverse range of ailments. Owing to its unique structure and properties, it also holds immense potential as a glycosyl donor in carbohydrate chemistry, presenting a promising avenue for further exploration in the field. However, its intricate molecular makeup necessitates considerable expertise in handling and manipulation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 39698-00-5 |
| Pricing | Inquire |
| Cas | 39698-00-5 |
| Molecular Weight | 388.37 |
| Molecular Formula | C17H24O10 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)OC(=O)C)OCC=C)OC(=O)C |