(+)-1,4-Di-O-benzyl-D-threitol
(+)-1,4-Di-O-benzyl-D-threitol, a highly prized compound within the biomedical industry, constitutes a vital component for the creation of groundbreaking pharmaceuticals. Unveiling its indispensability, this compound triumphs as an integral player in combating various ailments such as cancer and diabetes. Prudently procured from reputed suppliers, it guarantees unparalleled purity and efficacy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 91604-41-0 |
| Pricing | Inquire |
| Cas | 91604-41-0 |
| Molecular Weight | 302.36 |
| Molecular Formula | C18H22O4 |
| Canonical SMILES | C1=CC=C(C=C1)COCC(C(COCC2=CC=CC=C2)O)O |