tert-Butyl ((S)-2,6-Dimethyl-3-oxohept-1-en-4-yl)carbamate
tert-Butyl ((S)-2,6-Dimethyl-3-oxohept-1-en-4-yl)carbamate is an intermediate in the synthesis of (S)-2-Amino-4-methyl-1-((S)-2-methyloxiran-2-yl)pentan-1-one Trifluoroacetate Salt which is an impurity of carfilzomib (C183460). Carfilzomib is a second-generation proteasome inhibitor that is used as a treatment in relapsed and refractory multiple myeloma.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB070955 |
| Pricing | Inquire |
| Cas | 247068-81-1 |
| Molecular Weight | 255.35 |
| Molecular Formula | C14H25NO3 |
| Canonical SMILES | CC(C)CC(C(=O)C(=C)C)NC(=O)OC(C)(C)C |