2,3,4-Tri-O-acetyl-b-L-fucopyranosyl dibenzyl phosphate
2,3,4-Tri-O-acetyl-b-L-fucopyranosyl dibenzyl phosphate, a derivative of phosphorylated fucoside, is often employed in the production of glycolipids and glycoproteins. This compound displays a remarkable ability to selectively suppress specific fucosylated glycoenzymes that fuel tumor growth and metastasis, marking it as an excellent candidate for potential cancer therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 128473-05-2 |
| Pricing | Inquire |
| Cas | 128473-05-2 |
| Molecular Weight | 550.49 |
| Molecular Formula | C26H31O11P |
| Canonical SMILES | CC1C(C(C(C(O1)OP(=O)(OCC2=CC=CC=C2)OCC3=CC=CC=C3)OC(=O)C)OC(=O)C)OC(=O)C |