Potassium 1-Boc-1H-indole-5-trifluoroborate
Potassium 1-Boc-1H-indole-5-trifluoroborate is a chemical compound extensively employed in the biomedical industry. It exhibits its indispensability and versatility across manifold applications. As a fundamental building block, it seamlessly integrates into the synthesis of pharmaceutical drugs and organic molecules, imparting immense value to drug discovery endeavors. Notably, its paramount significance arises from its potential in revolutionizing the treatment landscape of ailments encompassing cancer, neurological disorders, and infectious maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1050440-92-0 |
| Pricing | Inquire |
| Cas | 1050440-92-0 |
| Molecular Weight | 323.16 |
| Molecular Formula | C13H14BF3KNO2 |
| Canonical SMILES | [B-](C1=CC2=C(C=C1)N(C=C2)C(=O)OC(C)(C)C)(F)(F)F.[K+] |