5-HEXYL-2-THIOPHENEBORONIC ACID PINACOL
5-HEXYL-2-THIOPHENEBORONIC ACID PINACOL is an essential biomedical compound with promising therapeutic properties, serves as a potential agent for treating specific afflictions. Employed extensively in pharmaceutical drug development, it effectively targets distinct receptors and enzymes linked to diverse diseases. This product significantly contributes to the progression of biomedical research and the facilitation of drug discovery endeavors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 917985-54-7 |
| Pricing | Inquire |
| Cas | 917985-54-7 |
| Molecular Weight | 294.26 |
| Molecular Formula | C16H27BO2S |
| Canonical SMILES | CCCCCCc1ccc(s1)B2OC(C)(C)C(C)(C)O2 |