Phenyl 2,3-di-O-benzoyl-b-D-thiogalactopyranoside
Phenyl 2,3-di-O-benzoyl-b-D-thiogalactopyranoside is a chemical compound widely used in the biomedical industry serving as an inhibitor for β-galactosidase enzymes. This compound aids in the investigation of various diseases, particularly those associated with galactose metabolism abnormalities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 138857-53-1 |
| Pricing | Inquire |
| Cas | 138857-53-1 |
| Molecular Weight | 480.5 |
| Molecular Formula | C26H24O7S |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OC2C(C(OC(C2OC(=O)C3=CC=CC=C3)SC4=CC=CC=C4)CO)O |