Ursolic acid
Ursolic acid is a natural pentacyclic triterpenoid carboxylic acid displaying antitumor activity. It was shown to downregulate the MMP-2 and uPA expression, and also inhibit Na+/K+-ATPase activity (IC50 = 24.7 μM) as well as NF-κB activation in various cancer cell lines. Ursolic acid can induce apoptosis in cancer cells. Ursolic acid also has obvious antioxidant function, so it is widely used as a raw material for medicine and cosmetics.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP6978 |
| Pricing | Inquire |
| Cas | 77-52-1 |
| Molecular Weight | 456.711 |
| Molecular Formula | C30H48O3 |
| Canonical SMILES | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C2C1C)C)C(=O)O |