Phenyl 2,3,4-tri-O-acetyl-b-L-thiorhamnopyranoside
Phenyl 2,3,4-tri-O-acetyl-β-L-thiorhamnopyranoside is a vital compound in the biomedical industry. With its unique chemical structure, it plays a crucial role in the development and research of drugs targeting various diseases. Its precise mechanism of action makes it a valuable tool for scientists working towards the discovery of novel therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 181136-65-2 |
| Pricing | Inquire |
| Cas | 181136-65-2 |
| Molecular Weight | 382.43 |
| Molecular Formula | C18H22O7S |
| Canonical SMILES | CC1C(C(C(C(O1)SC2=CC=CC=C2)OC(=O)C)OC(=O)C)OC(=O)C |