6-Amidino-2-Naphthol Methanesulfonic Acid
6-Amidino-2-naphthol methanesulfonic acid, a marvelously potent biological stain. It is oft harnessed for the powerful detection of arginine in amino acid sequences, affording scientists an unparalleled level of inquiry into the fundamental intricacies of protein structures. Notably, it facilitates a detailed exploration of the multifaceted functionality of arginine residues in such complex molecular ensembles.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2699-099061 |
| Pricing | Inquire |
| Cas | 82957-06-0 |
| Molecular Weight | 282.32 |
| Molecular Formula | C12H14N2O4S |
| Canonical SMILES | CS(=O)(=O)O.C1=CC2=C(C=CC(=C2)O)C=C1C(=N)N |