Bifendate Impurity G
Bifendate Impurity G is an impurity of Bifendate used in the therapy of liver diseases. Bifendate is a medication known for its hepatoprotective effects, specifically targeting and helping alleviate symptoms related to liver inflammation and damage caused by conditions such as hepatitis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 79279-08-6 |
| Pricing | Inquire |
| Cas | 79279-08-6 |
| Molecular Weight | 362.34 |
| Molecular Formula | C18H18O8 |
| Canonical SMILES | COC1=C2C(=C(C(=C1)CO)C3=C4C(=C(C=C3CO)OC)OCO4)OCO2 |