2'-Deoxy-5'-O-DMT-N2-isopropylguanosine
2'-Deoxy-5'-O-DMT-N2-isopropylguanosine is an indispensable compound in nucleic acid synthesis, emerging as a biomedical innovation. Unveiling its transformative potential, this modified guanosine variant proves instrumental in unravelling the intricate mechanisms underlying multifaceted ailments, including viral infections and cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 863910-15-0 |
| Pricing | Inquire |
| Cas | 863910-15-0 |
| Molecular Weight | 611.70 |
| Molecular Formula | C34H37N5O6 |
| Canonical SMILES | CC(C)NC1=NC2=C(C(=O)N1)N=CN2C3CC(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O |