2'-Deoxyguanylyl-(3'-5')-2'-deoxycytidine
2'-Deoxyguanylyl-(3'-5')-2'-deoxycytidine, a nucleotide analog, serves as an efficacious treatment for an array of viral infections with proven antiviral activities against RNA viruses, including hepatitis C and coronavirus. It is known to operate through mimicking natural nucleotides crucial for viral RNA synthesis, thereby obstructing viral replication. Highly potent, it acts as an excellent inhibitor of viral RNA-dependent RNA polymerases, making it a formidable weapon against some of the most debilitating viral diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 23405-83-6 |
| Pricing | Inquire |
| Cas | 23405-83-6 |
| Molecular Weight | 556.40 |
| Molecular Formula | C19H25N8O10P |
| Canonical SMILES | C1C(C(OC1N2C=CC(=NC2=O)N)COP(=O)(O)OC3CC(OC3CO)N4C=NC5=C4N=C(NC5=O)N)O |