Acremonidin B
Acremonidins A to approximately E (1 to approximately 5) were produced by fermentation of Acremonium sp. LL-Cyan 416, in heterogeneous phases. Acremonidins B showed moderate activity against Gram-positive bacteria, including the methicillin-resistant staphylococci and vancomycin-resistant enterococci.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00017 |
| Pricing | Inquire |
| Molecular Weight | 572.52 |
| Molecular Formula | C31H24O11 |
| Canonical SMILES | CC1=CC2=C(C(=C1)O)C(=C3C(=O)C4C=CC3(C2O)CC5=CC(=C(C(=C45)O)C(=O)C6=C(C=CC(=C6C(=O)OC)O)O)O)O |