Ethyl 2,4-dihydroxy-6-pentylbenzoate
Ethyl 2,4-dihydroxy-6-pentylbenzoate, a component recognized for its potential in tackling oxidative stress-related illnesses, cancer, and inflammation, stands out for its anti-inflammatory, anti-tumor, and antioxidant capabilities. Pharmaceutical prospects are keen to explore its therapeutic potential, given its unique properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2699-291238 |
| Pricing | Inquire |
| Cas | 38862-65-6 |
| Molecular Weight | 252.31 |
| Molecular Formula | C14H20O4 |
| Canonical SMILES | CCCCCC1=C(C(=CC(=C1)O)O)C(=O)OCC |