Amylin (14-20) (human)
The formation of amyloid deposits by IAPP can play a central role in the pathogenesis of type 2 diabetes. In addition to the amyloidogenic 20-29 region, the NFLVHSS domain (IAPP 14-20) tends to aggregate and seems to be involved in plaque formation.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-014737 |
| Pricing | Inquire |
| Cas | 121341-77-3 |
| Molecular Weight | 802.89 |
| Molecular Formula | C36H54N10O11 |
| Canonical SMILES | CC(C)CC(C(=O)NC(C(C)C)C(=O)NC(CC1=CN=CN1)C(=O)NC(CO)C(=O)NC(CO)C(=O)O)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(CC(=O)N)N |