6-Amino-6-deoxy-1,2-O-isopropylidene-a-D-glucofuranose HCl
6-Amino-6-deoxy-1,2-O-isopropylidene-α-D-glucofuranose hydrochloride is a renowned biomedical substance, finding its application in the research of viral infections and malignant tumors. Its utmost significance arises from its competence as a pivotal intermediary during the fabrication of diverse pharmaceuticals intended to target viral compounds or malignant neoplasms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 24384-88-1 |
| Pricing | Inquire |
| Cas | 24384-88-1 |
| Molecular Weight | 255.70 |
| Molecular Formula | C9H17NO5.HCl |
| Canonical SMILES | CC1(OC2C(C(OC2O1)C(CN)O)O)C.Cl |