Kumbicin C
Kumbicin C is a bis-indolyl benzenoid fungal metabolite produced by A. kumbius FRR6049. Kumbicin C was found to inhibit the growth of mouse myeloma cells (IC50 = 0.74 μg/mL) and the Gram-positive bacterium Bacillus subtilis (MIC = 1.6 μg/mL).
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-04490 |
| Pricing | Inquire |
| Cas | 1878151-58-6 |
| Molecular Weight | 436.50 |
| Molecular Formula | C28H24N2O3 |
| Canonical SMILES | CC1(C=CC2=C(C(=C(C(=C2O1)C3=CNC4=CC=CC=C43)OC)O)C5=CNC6=CC=CC=C65)C |