3'-O-Acetyl-2'-deoxyadenosine
3'-O-Acetyl-2'-deoxyadenosine, a highly esteemed compound embraced by the biomedical sector, stands as a paramount asset. Renowned for its unrivaled therapeutic prowess, it diligently combats a plethora of ailments such as malignant neoplasms and viral invasions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6612-73-3 |
| Pricing | Inquire |
| Cas | 6612-73-3 |
| Molecular Weight | 293.29 |
| Molecular Formula | C12H15N5O4 |
| Canonical SMILES | CC(=O)OC1CC(OC1CO)N2C=NC3=C(N=CN=C32)N |