Oseltamivir EP Impurity C
Oseltamivir EP Impurity C is the active metabolite of oseltamivir. Oseltamivir, also called as GS 4071 or Ro 64-0802, is an antiviral drug that competitively inhibits neuraminidase A and B (IC50 = 0.1 to 4.9 nM).
Supplier | BOC Sciences |
---|---|
Product # | B0084-172019 |
Pricing | Inquire |
Cas | 187227-45-8 |
Molecular Weight | 284.35 |
Molecular Formula | C14H24N2O4 |
Canonical SMILES | CCC(CC)OC1C=C(CC(C1NC(=O)C)N)C(=O)O |