5-Methylcyclocytidine hydrochlorine
5-Methylcyclocytidine hydrochlorine, a nucleoside analogue of cytidine, exhibits profound biomedical implications in combating specific ailments. Its inherent capability to impede nucleotide synthesis and viral replication positions it as a prospective anticancer and antiviral agent. However, elucidating its complete therapeutic prowess necessitates further comprehensive investigation, thus underscoring the importance of conducting extensive scientific research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 51391-96-9 |
| Pricing | Inquire |
| Cas | 51391-96-9 |
| Molecular Weight | 275.69 |
| Molecular Formula | C10H14ClN3O4 |
| Canonical SMILES | CC1=CN2C3C(C(C(O3)CO)O)OC2=NC1=N.Cl |