Dabigatran 3-Amino-3-oxopropyl
Dabigatran 3-Amino-3-oxopropyl is an impurity of Dabigatran. Dabigatran is a very potent anticoagulant, in which the terminal phenyl can be substituted by the more hydrophilic 2-pyridyl group without substantial loss of activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1643377-48-3 |
| Pricing | Inquire |
| Cas | 1643377-48-3 |
| Molecular Weight | 470.53 |
| Molecular Formula | C25H26N8O2 |
| Canonical SMILES | CN1C2=C(C=C(C=C2)C(=O)N(CCC(=O)N)C3=CC=CC=N3)N=C1CNC4=CC=C(C=C4)C(=N)N |