Lewis Y tetrasaccharide
Lewis Y tetrasaccharide is a remarkable and groundbreaking compound holding immense potential in studying an array of challenging cancers, including breast, ovarian and prostate cancers. By exerting its ingenious mechanism as a receptor antagonist, it profoundly obstructs the malignant interaction between Lewis Y antigen and malignant cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 82993-43-9 |
| Pricing | Inquire |
| Cas | 82993-43-9 |
| Molecular Weight | 675.64 |
| Molecular Formula | C26H45NO19 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)O)OC4C(C(C(C(O4)C)O)O)O)CO)O)NC(=O)C)O)O)O |