5-Methyluridine 5'-triphosphate
5-Methyluridine 5'-triphosphate is a pivotal constituent in the biomedical domain with applications extending to enzymatic investigations and nucleotide incorporation reactions. Moreover, this remarkable compound assumes a vital role in the development of antiviral therapeutics intended for RNA viruses, including the formidable hepatitis C virus. Furthermore, it serves as an indispensable precursor in the research and development of RNA molecules.
| Supplier | BOC Sciences |
|---|---|
| Product # | 23198-01-8 |
| Pricing | Inquire |
| Cas | 23198-01-8 |
| Molecular Weight | 498.17 |
| Molecular Formula | C10H17N2O15P3 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |