2',3'-Dideoxyguanosine-5'-triphosphate
2',3'-Dideoxyguanosine-5'-triphosphate] is a modified nucleotide that lacks a 3' hydroxyl group, making it an effective antiviral agent used in the treatment of RNA-based viral infections. It acts as a chain terminator during reverse transcription, inhibiting viral replication. Specifically, it is utilized in the treatment of HIV and hepatitis B to impede the growth and progression of these diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 85956-71-4 |
| Pricing | Inquire |
| Cas | 85956-71-4 |
| Molecular Weight | 331.22 |
| Molecular Formula | C10H14N5O6P |
| Canonical SMILES | C1CC(OC1COP(=O)(O)O)N2C=NC3=C2N=C(NC3=O)N |