Benzyl butyl phthalate
Benzyl Butyl Phthalate is a phthalate metabolite with genotoxic effect. Benzyl butyl phthalate activates aryl hydrocarbon receptor (AhR) in breast cancer cells to stimulate SPHK1/S1P/S1PR3 signaling and enhances formation of metastasis-initiating breast cancer stem cells (BCSCs).
| Supplier | BOC Sciences |
|---|---|
| Product # | 85-68-7 |
| Pricing | Inquire |
| Cas | 85-68-7 |
| Molecular Weight | 312.36 |
| Molecular Formula | C19H20O4 |
| Canonical SMILES | CCCCOC(=O)C1=CC=CC=C1C(=O)OCC2=CC=CC=C2 |