PD 334581
PD 334581, an analog of PD 184352, is an inhibitor of MEK1 that is used in biological studies to evaluate halogen bonding as a novel interaction for rational drug design.
| Supplier | BOC Sciences |
|---|---|
| Product # | 548756-68-9 |
| Pricing | Inquire |
| Cas | 548756-68-9 |
| Molecular Weight | 545.3 |
| Molecular Formula | C20H19F3IN5O2 |
| Canonical SMILES | C1COCCN1CCNC2=NN=C(O2)C3=C(C(=C(C=C3)F)F)NC4=C(C=C(C=C4)I)F |