Thalidomide-O-amido-PEG-C2-NH2 hydrochloride
Thalidomide-O-amido-PEG-C2-NH2 hydrochloride is a synthetic E3 ligand-linker conjugate containing a cereblon ligand based on Thalidomide and a PEG linker with terminal amine, as a part of a variety of functionalized PROTAC molecules for binding to a target protein ligand.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2204226-02-6 |
| Pricing | Inquire |
| Cas | 2204226-02-6 |
| Molecular Weight | 454.86 |
| Molecular Formula | C₁₉H₂₃ClN₄O₇ |
| Canonical SMILES | NCCOCCNC(COC1=C2C(N(C(C2=CC=C1)=O)C3CCC(NC3=O)=O)=O)=O.Cl |