Phenyl 2,3,4,6-tetra-O-benzyl-b-D-thiogalactopyranoside
Phenyl 2,3,4,6-tetra-O-benzyl-b-D-thiogalactopyranoside, an indispensible compound within the biomedical sector, serves diverse functionalities. This potent substrate engages in vital interactions with enzymes crucial for carbohydrate processing pathways. Its specific involvement in studying lactose intolerance and Gaucher's disease, alongside other glycoside-related disorders, demonstrates its monumental significance.
| Supplier | BOC Sciences |
|---|---|
| Product # | 74801-29-9 |
| Pricing | Inquire |
| Cas | 74801-29-9 |
| Molecular Weight | 632.82 |
| Molecular Formula | C40H41O5S |
| Canonical SMILES | C1=CC=C(C=C1)COCC2C(C(C(C(O2)SC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5)OCC6=CC=CC=C6 |