5'-O-DMT-N2-DMF-2'-deoxyguanosine 3'-CE phosphoramidite
5'-O-DMT-N2-DMF-2'-deoxyguanosine 3'-CE phosphoramidite, an indispensable constituent in the biomedical sector, finds extensive application in the synthesis of oligonucleotides for diagnostics and research studies. Its pivotal role encompasses the progress of nucleic acid-centered therapies and drug exploration, with a primary focus on combatting a wide range of diseases, encompassing cancer, genetic disorders, and viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2706-231724 |
| Pricing | Inquire |
| Cas | 330628-04-1 |
| Molecular Weight | 824.93 |
| Molecular Formula | C43H53N8O7P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC6=C5N=C(NC6=O)N=CN(C)C |