Mebendazole Impurity B
5-Benzoyl-1,3-dihydro-2H-benzimidazol-2-one contains a benzimidazolone moiety which has been seen to inhibit p38 MAP kinase , a crucial protein in the activation of biological factors related to psoriasis, rheumatoid arthritis and other inflammatory disea
| Supplier | BOC Sciences |
|---|---|
| Product # | 21472-33-3 |
| Pricing | Inquire |
| Cas | 21472-33-3 |
| Molecular Weight | 238.24 |
| Molecular Formula | C14H10N2O2 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)C2=CC3=C(C=C2)NC(=O)N3 |