N,N-Diacetyl-3,6,3,4,6-penta-O-acetyl-1-chlorochitobioside
N,N-Diacetyl-3,6,3,4,6-penta-O-acetyl-1-chlorochitobioside is a vital compound in biomedicine. It exhibits potential as an antiviral agent for treating specific diseases caused by viruses. Extensive research suggests its efficacy against viral infections, particularly those affecting the respiratory system. Studies have indicated its effectiveness in inhibiting viral replication and reducing viral load. The compound's unique structure and properties make it a promising candidate for the development of novel antiviral therapies in the biomedical field.
| Supplier | BOC Sciences |
|---|---|
| Product # | 7531-49-9 |
| Pricing | Inquire |
| Cas | 7531-49-9 |
| Molecular Weight | 653.03 |
| Molecular Formula | C26H37ClN2O15 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC2C(OC(C(C2OC(=O)C)NC(=O)C)Cl)COC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C |