22:6 PS (sodium salt)
22:6 PS (sodium salt) is a lipid compound derived from phosphatidylserine (PS), containing a 22:6 fatty acyl group. This molecule shows promise in the field of neurodegenerative disorders like Alzheimer's disease, ADHD, and age-associated cognitive impairment, owing to its potential therapeutic properties and neuroprotective effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | 474943-19-6 |
| Pricing | Inquire |
| Cas | 474943-19-6 |
| Molecular Weight | 902.08 |
| Molecular Formula | C50H73NNaO10P |
| Canonical SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)([O-])OCC(C(=O)[O-])[NH3+])OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC.[Na+] |