Dihydroguaiaretic acid
Meso-dihydroguaiarectic acid (MDGA), coming from the aerial parts of Saururus chinensis, significantly protect primary cultured neuronal cells against glutamate-induced oxidative stress, via antioxidative activities. It might provide a basis for novel anti-inflammatory drug development. Meso-dihydroguaiaretic acid (MDGA) inhibits the cyclooxygenase-2 (COX-2)-dependent phase of prostaglandin D2 (PGD2) generation in bone marrow-derived mast cells (BMMC) (IC50 9.8 μM). Besides, Dihydroguaiaretic acid (DHGA) showed an inhibitory effect against the complex formation of the fos-jun dimer and the DNA consensus sequence with an IC50 value of 0.21 micromol. DHGA suppressed leukemia, lung cancer and colon cancer in an in vitro bioassay.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP3978 |
| Pricing | Inquire |
| Cas | 66322-34-7 |
| Molecular Weight | 330.4 |
| Molecular Formula | C20H26O4 |
| Canonical SMILES | CC(CC1=CC(=C(C=C1)O)OC)C(C)CC2=CC(=C(C=C2)O)OC |