Indole-6-boronic Acid
Reactant involved in synthesis of: Indole compounds for use as HIV-1 glycoprotein-41 fusion inhibitors; δ-Carbolines / carbozoles; Trisubstituted pyrimidines as PI3K inhibitors; (Thienopyridine)carboxamides as CHK1 inhibitors; cis-FluorostilbenesReactant involved in Suzuki-Miyaura reactions. Used in a study of racemization in Suzuki cross-couplings of arylamino acids.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB010218 |
| Pricing | Inquire |
| Cas | 147621-18-9 |
| Molecular Weight | 160.97 |
| Molecular Formula | C8H8NO2B |
| Canonical SMILES | B(C1=CC2=C(C=C1)C=CN2)(O)O |