Carbocyclic-3'-fluoro-2',3'-dideoxyadenosine
Carbocyclic-3'-fluoro-2',3'-dideoxyadenosine is an influential and compelling antiviral nucleoside analog, commonly employed within the biomedical sector. Renowned for its profound inhibitory effects on the reverse transcriptase enzyme, this remarkable compound has proven efficacy in combatting RNA viral infections, including hepatitis C and HIV.
| Supplier | BOC Sciences |
|---|---|
| Product # | 118189-68-7 |
| Pricing | Inquire |
| Cas | 118189-68-7 |
| Molecular Weight | 251.26 |
| Molecular Formula | C11H14FN5O |
| Canonical SMILES | C1C(CC(C1CO)F)N2C=NC3=C(N=CN=C32)N |