Cys(Npys)-(Arg)9
It is a peptide composed of 9 arginine residues synthesized from an activated cysteine residue C(Npys), where Npys is 3-Nitro-2-pyridinesulfenyl protective cysteine. The S(Npys) group of this cysteine-containing 9R is capable of reacting selectively with the free thiol group of another cysteine-containing peptide to form an unsymmetrical disulfide bond. Coupling of sulfhydrils has been studied as an effective means to deliver/release therapeutic agents such as siRNA in the reducing environment within the cell.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-013307 |
| Pricing | Inquire |
| Cas | 1417221-06-7 |
| Molecular Weight | 1679.99 |
| Molecular Formula | C62H118N40O12S2 |
| Canonical SMILES | C1=CC(=C(N=C1)SSCC(C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCNC(=N)N)C(=O)N)N)[N+](=O)[O-] |