7-Deaza-7-iodoguanosine
7-Deaza-7-iodoguanosine, a pivotal compound essential in the realm of biomedicine, emerges as an imperative agent employed for combating diverse afflictions. Remarkably, this compound unveils profound antiviral efficacy against notorious pathogens such as herpes simplex virus, vaccinia virus, and cytomegalovirus. Consequently, it serves as an invaluable asset facilitating the progress of antiviral drug investigations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 444020-71-7 |
| Pricing | Inquire |
| Cas | 444020-71-7 |
| Molecular Weight | 408.15 |
| Molecular Formula | C11H13IN4O5 |
| Canonical SMILES | C1=C(C2=C(N=CN=C2N1C3C(C(C(O3)CO)O)O)N)I |