4-Nitrophenyl 2-O-(b-D-glucopyranosyl)-b-D-glucopyranoside
4-Nitrophenyl 2-O-(β-D-glucopyranosyl)-β-D-glucopyranoside, an extensively utilized biomedical compound, exhibits remarkable efficacy in investigating metabolic disorders such as glucose metabolism impairment. Serving as a substrate analog, it facilitates the evaluation of enzyme efficiency pertaining to glycosylation processes. Furthermore, its implementation as a probe allows for an in-depth exploration of the involvement of glycosidases in diverse pathological conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 16790-33-3 |
| Pricing | Inquire |
| Cas | 16790-33-3 |
| Molecular Weight | 463.39 |
| Molecular Formula | C18H25NO13 |
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2C(C(C(C(O2)COC3C(C(C(C(O3)CO)O)O)O)O)O)O |