9'-Methyl salvianolate B
9'-Methyl salvianolate B is a biomedical product used for the research of cardiovascular diseases. It exhibits strong antioxidant and anti-inflammatory properties. This natural compound is derived from Salviae miltiorrhizae.
Supplier | BOC Sciences |
---|---|
Product # | 1167424-32-9 |
Pricing | Inquire |
Cas | 1167424-32-9 |
Molecular Weight | 732.6 |
Molecular Formula | C37H32O16 |
Canonical SMILES | COC(=O)C(CC1=CC(=C(C=C1)O)O)OC(=O)C=CC2=C3C(C(OC3=C(C=C2)O)C4=CC(=C(C=C4)O)O)C(=O)OC(CC5=CC(=C(C=C5)O)O)C(=O)O |