1,3,4-Tri-O-acetyl-2-deoxy-D-ribopyranose
1,3,4-Tri-O-acetyl-2-deoxy-D-ribopyranose, a carbohydrate molecule, is a crucial biochemical component utilized in the production of numerous pharmaceuticals. Its therapeutic potential has been exploited, with derivatives undergoing rigorous testing for their efficacy in treating a wide range of pathological states such as cancer, tuberculosis and HIV. The intricate interplay of chemical interactions occurring within the molecule presents a fascinating realm of research and development in modern medical science.
| Supplier | BOC Sciences |
|---|---|
| Product # | 95585-77-6 |
| Pricing | Inquire |
| Cas | 95585-77-6 |
| Molecular Weight | 260.24 |
| Molecular Formula | C11H16O7 |
| Canonical SMILES | CC(=O)OC1CC(OCC1OC(=O)C)OC(=O)C |